C16H16IN6- — CID 163860957
[(S)-cyclopentyl-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]methyl]iodanuidylformonitrile (PubChem CID 163860957) has the molecular formula C16H16IN6- and a molecular weight of 419.25 g/mol. Its IUPAC name is [(S)-cyclopentyl-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]methyl]iodanuidylformonitrile.
| Compound Name | [(S)-cyclopentyl-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]methyl]iodanuidylformonitrile |
|---|---|
| PubChem CID | 163860957 |
| Molecular Formula | C16H16IN6- |
| Molecular Weight | 419.25 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | [(S)-cyclopentyl-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]methyl]iodanuidylformonitrile |
| SMILES | N#C[I-][C@@H](C1CCCC1)n1cc(-c2ncnc3[nH]ccc23)cn1 |
| InChI | InChI=1S/C16H16IN6/c18-9-17-15(11-3-1-2-4-11)23-8-12(7-22-23)14-13-5-6-19-16(13)21-10-20-14/h5-8,10-11,15H,1-4H2,(H,19,20,21)/q-1/t15-/m1/s1 |
| InChIKey | UFJNPNVMCASXGC-OAHLLOKOSA-N |
| XLogP | 0.08 |
| TPSA | 83.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.25 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|