C17H19N6O4P — CID 175691880
3-cyclopentyl-3-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]prop-2-enenitrile;phosphoric acid (PubChem CID 175691880) has the molecular formula C17H19N6O4P and a molecular weight of 402.35 g/mol. Its IUPAC name is 3-cyclopentyl-3-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]prop-2-enenitrile;phosphoric acid.
| Compound Name | 3-cyclopentyl-3-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]prop-2-enenitrile;phosphoric acid |
|---|---|
| PubChem CID | 175691880 |
| Molecular Formula | C17H19N6O4P |
| Molecular Weight | 402.35 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 3-cyclopentyl-3-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]prop-2-enenitrile;phosphoric acid |
| SMILES | N#CC=C(C1CCCC1)n1cc(-c2ncnc3[nH]ccc23)cn1.O=P(O)(O)O |
| InChI | InChI=1S/C17H16N6.H3O4P/c18-7-5-15(12-3-1-2-4-12)23-10-13(9-22-23)16-14-6-8-19-17(14)21-11-20-16;1-5(2,3)4/h5-6,8-12H,1-4H2,(H,19,20,21);(H3,1,2,3,4) |
| InChIKey | JTEPWHXEHHFZNN-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 160.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|