C17H21N6O4P — CID 174645704
[3-cyclopentyl-4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl] dihydrogen phosphate;propanenitrile (PubChem CID 174645704) has the molecular formula C17H21N6O4P and a molecular weight of 404.37 g/mol. Its IUPAC name is [3-cyclopentyl-4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl] dihydrogen phosphate;propanenitrile.
| Compound Name | [3-cyclopentyl-4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl] dihydrogen phosphate;propanenitrile |
|---|---|
| PubChem CID | 174645704 |
| Molecular Formula | C17H21N6O4P |
| Molecular Weight | 404.37 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | [3-cyclopentyl-4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl] dihydrogen phosphate;propanenitrile |
| SMILES | CCC#N.O=P(O)(O)On1cc(-c2ncnc3[nH]ccc23)c(C2CCCC2)n1 |
| InChI | InChI=1S/C14H16N5O4P.C3H5N/c20-24(21,22)23-19-7-11(12(18-19)9-3-1-2-4-9)13-10-5-6-15-14(10)17-8-16-13;1-2-3-4/h5-9H,1-4H2,(H,15,16,17)(H2,20,21,22);2H2,1H3 |
| InChIKey | GQNKKBGIFHEYTB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 149.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.37 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|