C17H21N6O4P — CID 154809832
3-[3-cyclopentyl-4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]propanenitrile;phosphoric acid (PubChem CID 154809832) has the molecular formula C17H21N6O4P and a molecular weight of 404.37 g/mol. Its IUPAC name is 3-[3-cyclopentyl-4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]propanenitrile;phosphoric acid.
| Compound Name | 3-[3-cyclopentyl-4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]propanenitrile;phosphoric acid |
|---|---|
| PubChem CID | 154809832 |
| Molecular Formula | C17H21N6O4P |
| Molecular Weight | 404.37 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 3-[3-cyclopentyl-4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]propanenitrile;phosphoric acid |
| SMILES | N#CCCn1cc(-c2ncnc3[nH]ccc23)c(C2CCCC2)n1.O=P(O)(O)O |
| InChI | InChI=1S/C17H18N6.H3O4P/c18-7-3-9-23-10-14(15(22-23)12-4-1-2-5-12)16-13-6-8-19-17(13)21-11-20-16;1-5(2,3)4/h6,8,10-12H,1-5,9H2,(H,19,20,21);(H3,1,2,3,4) |
| InChIKey | BTCDIQCTFJCFCK-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 160.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|