C12H12N5O4P — CID 174645719
[3-cyclopropyl-4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl] dihydrogen phosphate (PubChem CID 174645719) has the molecular formula C12H12N5O4P and a molecular weight of 321.23 g/mol. Its IUPAC name is [3-cyclopropyl-4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl] dihydrogen phosphate.
| Compound Name | [3-cyclopropyl-4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 174645719 |
| Molecular Formula | C12H12N5O4P |
| Molecular Weight | 321.23 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | [3-cyclopropyl-4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl] dihydrogen phosphate |
| SMILES | O=P(O)(O)On1cc(-c2ncnc3[nH]ccc23)c(C2CC2)n1 |
| InChI | InChI=1S/C12H12N5O4P/c18-22(19,20)21-17-5-9(10(16-17)7-1-2-7)11-8-3-4-13-12(8)15-6-14-11/h3-7H,1-2H2,(H,13,14,15)(H2,18,19,20) |
| InChIKey | VPULFKSWZNUGIL-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 126.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.23 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|