C19H24N4 — CID 163644754
5-methyl-6-[(2R)-2-methylcyclohexyl]-1-(1-methylpyrazol-4-yl)indazole (PubChem CID 163644754) has the molecular formula C19H24N4 and a molecular weight of 308.43 g/mol. Its IUPAC name is 5-methyl-6-[(2R)-2-methylcyclohexyl]-1-(1-methylpyrazol-4-yl)indazole.
| Compound Name | 5-methyl-6-[(2R)-2-methylcyclohexyl]-1-(1-methylpyrazol-4-yl)indazole |
|---|---|
| PubChem CID | 163644754 |
| Molecular Formula | C19H24N4 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 5-methyl-6-[(2R)-2-methylcyclohexyl]-1-(1-methylpyrazol-4-yl)indazole |
| SMILES | Cc1cc2cnn(-c3cnn(C)c3)c2cc1C1CCCC[C@H]1C |
| InChI | InChI=1S/C19H24N4/c1-13-6-4-5-7-17(13)18-9-19-15(8-14(18)2)10-21-23(19)16-11-20-22(3)12-16/h8-13,17H,4-7H2,1-3H3/t13-,17?/m1/s1 |
| InChIKey | URPIZIOEWHDTRY-FWJOYPJLSA-N |
| XLogP | 4.36 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |