C24H29N7O — CID 163645764
12-(1-methylpyrazol-4-yl)-N-(4-morpholin-4-ylcyclohexyl)-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-3-amine (PubChem CID 163645764) has the molecular formula C24H29N7O and a molecular weight of 431.54 g/mol. Its IUPAC name is 12-(1-methylpyrazol-4-yl)-N-(4-morpholin-4-ylcyclohexyl)-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-3-amine.
| Compound Name | 12-(1-methylpyrazol-4-yl)-N-(4-morpholin-4-ylcyclohexyl)-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-3-amine |
|---|---|
| PubChem CID | 163645764 |
| Molecular Formula | C24H29N7O |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.24 |
| IUPAC Name | 12-(1-methylpyrazol-4-yl)-N-(4-morpholin-4-ylcyclohexyl)-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-3-amine |
| SMILES | Cn1cc(-c2cc3c(cn2)Cc2ncnc(NC4CCC(N5CCOCC5)CC4)c2-3)cn1 |
| InChI | InChI=1S/C24H29N7O/c1-30-14-17(13-28-30)21-11-20-16(12-25-21)10-22-23(20)24(27-15-26-22)29-18-2-4-19(5-3-18)31-6-8-32-9-7-31/h11-15,18-19H,2-10H2,1H3,(H,26,27,29) |
| InChIKey | HBWXCGGHTYJAPP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 80.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |