C24H29FN6O — CID 130446931
7-fluoro-6-[5-(methylamino)-3-pyridinyl]-N-(4-morpholin-4-ylcyclohexyl)quinazolin-4-amine (PubChem CID 130446931) has the molecular formula C24H29FN6O and a molecular weight of 436.54 g/mol. Its IUPAC name is 7-fluoro-6-[5-(methylamino)-3-pyridinyl]-N-(4-morpholin-4-ylcyclohexyl)quinazolin-4-amine.
| Compound Name | 7-fluoro-6-[5-(methylamino)-3-pyridinyl]-N-(4-morpholin-4-ylcyclohexyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 130446931 |
| Molecular Formula | C24H29FN6O |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | 7-fluoro-6-[5-(methylamino)-3-pyridinyl]-N-(4-morpholin-4-ylcyclohexyl)quinazolin-4-amine |
| SMILES | CNc1cncc(-c2cc3c(NC4CCC(N5CCOCC5)CC4)ncnc3cc2F)c1 |
| InChI | InChI=1S/C24H29FN6O/c1-26-18-10-16(13-27-14-18)20-11-21-23(12-22(20)25)28-15-29-24(21)30-17-2-4-19(5-3-17)31-6-8-32-9-7-31/h10-15,17,19,26H,2-9H2,1H3,(H,28,29,30) |
| InChIKey | HQFJWBAVTNEYNA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |