C10H17NO3 — CID 163652264
(Z)-5-methoxy-2,6-dimethyl-2-nitrosohept-4-en-3-one (PubChem CID 163652264) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is (Z)-5-methoxy-2,6-dimethyl-2-nitrosohept-4-en-3-one.
| Compound Name | (Z)-5-methoxy-2,6-dimethyl-2-nitrosohept-4-en-3-one |
|---|---|
| PubChem CID | 163652264 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | (Z)-5-methoxy-2,6-dimethyl-2-nitrosohept-4-en-3-one |
| SMILES | CO/C(=C\C(=O)C(C)(C)N=O)C(C)C |
| InChI | InChI=1S/C10H17NO3/c1-7(2)8(14-5)6-9(12)10(3,4)11-13/h6-7H,1-5H3/b8-6- |
| InChIKey | INEWYPGTPZOIPF-VURMDHGXSA-N |
| XLogP | 2.29 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|