C21H23FN4O3 — CID 163655876
[4-(4-fluorophenyl)piperazin-1-yl]-(2-morpholin-4-yl-5-nitrosophenyl)methanone (PubChem CID 163655876) has the molecular formula C21H23FN4O3 and a molecular weight of 398.44 g/mol. Its IUPAC name is [4-(4-fluorophenyl)piperazin-1-yl]-(2-morpholin-4-yl-5-nitrosophenyl)methanone.
| Compound Name | [4-(4-fluorophenyl)piperazin-1-yl]-(2-morpholin-4-yl-5-nitrosophenyl)methanone |
|---|---|
| PubChem CID | 163655876 |
| Molecular Formula | C21H23FN4O3 |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | [4-(4-fluorophenyl)piperazin-1-yl]-(2-morpholin-4-yl-5-nitrosophenyl)methanone |
| SMILES | O=Nc1ccc(N2CCOCC2)c(C(=O)N2CCN(c3ccc(F)cc3)CC2)c1 |
| InChI | InChI=1S/C21H23FN4O3/c22-16-1-4-18(5-2-16)24-7-9-26(10-8-24)21(27)19-15-17(23-28)3-6-20(19)25-11-13-29-14-12-25/h1-6,15H,7-14H2 |
| InChIKey | IQDXHARILXHZLA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 65.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|