C23H26N4O2S — CID 143289155
4-[4-(5-methylsulfanyl-2-morpholin-4-ylbenzoyl)piperazin-1-yl]benzonitrile (PubChem CID 143289155) has the molecular formula C23H26N4O2S and a molecular weight of 422.55 g/mol. Its IUPAC name is 4-[4-(5-methylsulfanyl-2-morpholin-4-ylbenzoyl)piperazin-1-yl]benzonitrile.
| Compound Name | 4-[4-(5-methylsulfanyl-2-morpholin-4-ylbenzoyl)piperazin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 143289155 |
| Molecular Formula | C23H26N4O2S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 4-[4-(5-methylsulfanyl-2-morpholin-4-ylbenzoyl)piperazin-1-yl]benzonitrile |
| SMILES | CSc1ccc(N2CCOCC2)c(C(=O)N2CCN(c3ccc(C#N)cc3)CC2)c1 |
| InChI | InChI=1S/C23H26N4O2S/c1-30-20-6-7-22(26-12-14-29-15-13-26)21(16-20)23(28)27-10-8-25(9-11-27)19-4-2-18(17-24)3-5-19/h2-7,16H,8-15H2,1H3 |
| InChIKey | GWPAHZGRCKETLK-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 59.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |