C9H15N — CID 163656481
N-[(1S,2S)-2-methylcyclohept-3-en-1-yl]methanimine (PubChem CID 163656481) has the molecular formula C9H15N and a molecular weight of 137.23 g/mol. Its IUPAC name is N-[(1S,2S)-2-methylcyclohept-3-en-1-yl]methanimine.
| Compound Name | N-[(1S,2S)-2-methylcyclohept-3-en-1-yl]methanimine |
|---|---|
| PubChem CID | 163656481 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | N-[(1S,2S)-2-methylcyclohept-3-en-1-yl]methanimine |
| SMILES | C=N[C@H]1CCCC=C[C@@H]1C |
| InChI | InChI=1S/C9H15N/c1-8-6-4-3-5-7-9(8)10-2/h4,6,8-9H,2-3,5,7H2,1H3/t8-,9-/m0/s1 |
| InChIKey | IQQQWYZBVMQZOK-IUCAKERBSA-N |
| XLogP | 2.43 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|