C19H18N8O2 — CID 163656999
N-[3-[[5-cyano-2-[(1-ethenylpyrazol-4-yl)amino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]cyclobutyl]prop-2-enamide (PubChem CID 163656999) has the molecular formula C19H18N8O2 and a molecular weight of 390.41 g/mol. Its IUPAC name is N-[3-[[5-cyano-2-[(1-ethenylpyrazol-4-yl)amino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]cyclobutyl]prop-2-enamide.
| Compound Name | N-[3-[[5-cyano-2-[(1-ethenylpyrazol-4-yl)amino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]cyclobutyl]prop-2-enamide |
|---|---|
| PubChem CID | 163656999 |
| Molecular Formula | C19H18N8O2 |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | N-[3-[[5-cyano-2-[(1-ethenylpyrazol-4-yl)amino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]cyclobutyl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CC(Oc2nc(Nc3cnn(C=C)c3)nc3[nH]cc(C#N)c23)C1 |
| InChI | InChI=1S/C19H18N8O2/c1-3-15(28)23-12-5-14(6-12)29-18-16-11(7-20)8-21-17(16)25-19(26-18)24-13-9-22-27(4-2)10-13/h3-4,8-10,12,14H,1-2,5-6H2,(H,23,28)(H2,21,24,25,26) |
| InChIKey | IRCHWHLRVYKDMO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 133.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|