About 1-methoxy-2-methylperoxy-1,2-dioxidohydrazine
1-methoxy-2-methylperoxy-1,2-dioxidohydrazine (PubChem CID 163658013) has the molecular formula C2H6N2O5-2
and a molecular weight of 138.08 g/mol. Its IUPAC name is 1-methoxy-2-methylperoxy-1,2-dioxidohydrazine.
Molecular Properties
| Compound Name | 1-methoxy-2-methylperoxy-1,2-dioxidohydrazine |
| PubChem CID | 163658013 |
| Molecular Formula | C2H6N2O5-2 |
| Molecular Weight | 138.08 g/mol |
| Exact Mass | 138.03 |
| IUPAC Name | 1-methoxy-2-methylperoxy-1,2-dioxidohydrazine |
| SMILES | COON([O-])N([O-])OC |
| InChI | InChI=1S/C2H6N2O5/c1-7-3(5)4(6)9-8-2/h1-2H3/q-2 |
| InChIKey | OJHJZTJBIYMSKT-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.08 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxy-2-methylperoxy-1,2-dioxidohydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-2-methylperoxy-1,2-dioxidohydrazine?
The IUPAC name of 1-methoxy-2-methylperoxy-1,2-dioxidohydrazine (CID 163658013) is 1-methoxy-2-methylperoxy-1,2-dioxidohydrazine.
What is the SMILES notation for 1-methoxy-2-methylperoxy-1,2-dioxidohydrazine?
The canonical SMILES for 1-methoxy-2-methylperoxy-1,2-dioxidohydrazine is COON([O-])N([O-])OC.
What is the InChIKey of 1-methoxy-2-methylperoxy-1,2-dioxidohydrazine?
The InChIKey is OJHJZTJBIYMSKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6N2O5/c1-7-3(5)4(6)9-8-2/h1-2H3/q-2.
What are the key properties of 1-methoxy-2-methylperoxy-1,2-dioxidohydrazine?
1-methoxy-2-methylperoxy-1,2-dioxidohydrazine has a molecular weight of 138.08 g/mol, XLogP of -0.44, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-2-methylperoxy-1,2-dioxidohydrazine is sourced from PubChem (CID 163658013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).