C17H15NO3S — CID 163659141
S-[2-(2-oxoethylcarbamoyl)phenyl] 3-methylbenzenecarbothioate (PubChem CID 163659141) has the molecular formula C17H15NO3S and a molecular weight of 313.38 g/mol. Its IUPAC name is S-[2-(2-oxoethylcarbamoyl)phenyl] 3-methylbenzenecarbothioate.
| Compound Name | S-[2-(2-oxoethylcarbamoyl)phenyl] 3-methylbenzenecarbothioate |
|---|---|
| PubChem CID | 163659141 |
| Molecular Formula | C17H15NO3S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | S-[2-(2-oxoethylcarbamoyl)phenyl] 3-methylbenzenecarbothioate |
| SMILES | Cc1cccc(C(=O)Sc2ccccc2C(=O)NCC=O)c1 |
| InChI | InChI=1S/C17H15NO3S/c1-12-5-4-6-13(11-12)17(21)22-15-8-3-2-7-14(15)16(20)18-9-10-19/h2-8,10-11H,9H2,1H3,(H,18,20) |
| InChIKey | ISWIMLXZBUJZFL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|