C11H19N3 — CID 163660111
1-(3-methylbuta-1,3-dien-2-yl)-2-(3-methylbut-3-en-2-yl)guanidine (PubChem CID 163660111) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is 1-(3-methylbuta-1,3-dien-2-yl)-2-(3-methylbut-3-en-2-yl)guanidine.
| Compound Name | 1-(3-methylbuta-1,3-dien-2-yl)-2-(3-methylbut-3-en-2-yl)guanidine |
|---|---|
| PubChem CID | 163660111 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 1-(3-methylbuta-1,3-dien-2-yl)-2-(3-methylbut-3-en-2-yl)guanidine |
| SMILES | C=C(C)C(=C)N/C(N)=N/C(C)C(=C)C |
| InChI | InChI=1S/C11H19N3/c1-7(2)9(5)13-11(12)14-10(6)8(3)4/h10H,1,3,5H2,2,4,6H3,(H3,12,13,14) |
| InChIKey | ITRCDDPYJDXIBD-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|