C32H36FNO3 — CID 163660118
(2S)-1-[[2-(3-fluoropropoxy)-5-methyl-4-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]phenyl]methyl]piperidine-2-carboxylic acid (PubChem CID 163660118) has the molecular formula C32H36FNO3 and a molecular weight of 501.64 g/mol. Its IUPAC name is (2S)-1-[[2-(3-fluoropropoxy)-5-methyl-4-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]phenyl]methyl]piperidine-2-carboxylic acid.
| Compound Name | (2S)-1-[[2-(3-fluoropropoxy)-5-methyl-4-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]phenyl]methyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 163660118 |
| Molecular Formula | C32H36FNO3 |
| Molecular Weight | 501.64 g/mol |
| Exact Mass | 501.27 |
| IUPAC Name | (2S)-1-[[2-(3-fluoropropoxy)-5-methyl-4-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]phenyl]methyl]piperidine-2-carboxylic acid |
| SMILES | Cc1cc(CN2CCCC[C@H]2C(=O)O)c(OCCCF)cc1/C=C/c1cccc(-c2ccccc2)c1C |
| InChI | InChI=1S/C32H36FNO3/c1-23-20-28(22-34-18-7-6-14-30(34)32(35)36)31(37-19-9-17-33)21-27(23)16-15-25-12-8-13-29(24(25)2)26-10-4-3-5-11-26/h3-5,8,10-13,15-16,20-21,30H,6-7,9,14,17-19,22H2,1-2H3,(H,35,36)/b16-15+/t30-/m0/s1 |
| InChIKey | ITRGDRRMHRXSDN-OMCKQGILSA-N |
| XLogP | 7.32 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.64 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|