C20H21FI3N5O2S — CID 163660480
(2S)-1-N-[5-[2-(3-fluoro-2,3-diiodopent-4-en-2-yl)-4-pyridinyl]-4-methyl-1,3-thiazol-2-yl]-2-N-iodopyrrolidine-1,2-dicarboxamide (PubChem CID 163660480) has the molecular formula C20H21FI3N5O2S and a molecular weight of 795.20 g/mol. Its IUPAC name is (2S)-1-N-[5-[2-(3-fluoro-2,3-diiodopent-4-en-2-yl)-4-pyridinyl]-4-methyl-1,3-thiazol-2-yl]-2-N-iodopyrrolidine-1,2-dicarboxamide.
| Compound Name | (2S)-1-N-[5-[2-(3-fluoro-2,3-diiodopent-4-en-2-yl)-4-pyridinyl]-4-methyl-1,3-thiazol-2-yl]-2-N-iodopyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 163660480 |
| Molecular Formula | C20H21FI3N5O2S |
| Molecular Weight | 795.20 g/mol |
| Exact Mass | 794.85 |
| IUPAC Name | (2S)-1-N-[5-[2-(3-fluoro-2,3-diiodopent-4-en-2-yl)-4-pyridinyl]-4-methyl-1,3-thiazol-2-yl]-2-N-iodopyrrolidine-1,2-dicarboxamide |
| SMILES | C=CC(F)(I)C(C)(I)c1cc(-c2sc(NC(=O)N3CCC[C@H]3C(=O)NI)nc2C)ccn1 |
| InChI | InChI=1S/C20H21FI3N5O2S/c1-4-20(21,23)19(3,22)14-10-12(7-8-25-14)15-11(2)26-17(32-15)27-18(31)29-9-5-6-13(29)16(30)28-24/h4,7-8,10,13H,1,5-6,9H2,2-3H3,(H,28,30)(H,26,27,31)/t13-,19?,20?/m0/s1 |
| InChIKey | ITYSONFLDBMEKP-LJLKPOLSSA-N |
| XLogP | 5.91 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.20 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|