C19H13FN4O3S — CID 163663114
(5Z)-5-[[3-(3-fluoro-4-hydroperoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 163663114) has the molecular formula C19H13FN4O3S and a molecular weight of 396.40 g/mol. Its IUPAC name is (5Z)-5-[[3-(3-fluoro-4-hydroperoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[[3-(3-fluoro-4-hydroperoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 163663114 |
| Molecular Formula | C19H13FN4O3S |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | (5Z)-5-[[3-(3-fluoro-4-hydroperoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | O=C1NC(=S)N/C1=C\c1cn(-c2ccccc2)nc1-c1ccc(OO)c(F)c1 |
| InChI | InChI=1S/C19H13FN4O3S/c20-14-8-11(6-7-16(14)27-26)17-12(9-15-18(25)22-19(28)21-15)10-24(23-17)13-4-2-1-3-5-13/h1-10,26H,(H2,21,22,25,28)/b15-9- |
| InChIKey | IWBUUTOPBUXRBD-DHDCSXOGSA-N |
| XLogP | 2.88 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|