C21H16N4O3S — CID 6520756
(5Z)-5-[[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 6520756) has the molecular formula C21H16N4O3S and a molecular weight of 404.45 g/mol. Its IUPAC name is (5Z)-5-[[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 6520756 |
| Molecular Formula | C21H16N4O3S |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | (5Z)-5-[[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | O=C1NC(=S)N/C1=C\c1cn(-c2ccccc2)nc1-c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C21H16N4O3S/c26-20-16(22-21(29)23-20)10-14-12-25(15-4-2-1-3-5-15)24-19(14)13-6-7-17-18(11-13)28-9-8-27-17/h1-7,10-12H,8-9H2,(H2,22,23,26,29)/b16-10- |
| InChIKey | NYQQDRKWCJYXGL-YBEGLDIGSA-N |
| XLogP | 2.66 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|