About 6-bromo-2-fluoro-3-[(3S)-oxolan-3-yl]oxybenzonitrile;sulfane
6-bromo-2-fluoro-3-[(3S)-oxolan-3-yl]oxybenzonitrile;sulfane (PubChem CID 163664518) has the molecular formula C11H11BrFNO2S
and a molecular weight of 320.18 g/mol. Its IUPAC name is 6-bromo-2-fluoro-3-[(3S)-oxolan-3-yl]oxybenzonitrile;sulfane.
Molecular Properties
| Compound Name | 6-bromo-2-fluoro-3-[(3S)-oxolan-3-yl]oxybenzonitrile;sulfane |
| PubChem CID | 163664518 |
| Molecular Formula | C11H11BrFNO2S |
| Molecular Weight | 320.18 g/mol |
| Exact Mass | 318.97 |
| IUPAC Name | 6-bromo-2-fluoro-3-[(3S)-oxolan-3-yl]oxybenzonitrile;sulfane |
| SMILES | N#Cc1c(Br)ccc(O[C@H]2CCOC2)c1F.S |
| InChI | InChI=1S/C11H9BrFNO2.H2S/c12-9-1-2-10(11(13)8(9)5-14)16-7-3-4-15-6-7;/h1-2,7H,3-4,6H2;1H2/t7-;/m0./s1 |
| InChIKey | IXGGEQFKXQSGSG-FJXQXJEOSA-N |
| XLogP | 2.74 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.18 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-bromo-2-fluoro-3-[(3S)-oxolan-3-yl]oxybenzonitrile;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2-fluoro-3-[(3S)-oxolan-3-yl]oxybenzonitrile;sulfane?
The IUPAC name of 6-bromo-2-fluoro-3-[(3S)-oxolan-3-yl]oxybenzonitrile;sulfane (CID 163664518) is 6-bromo-2-fluoro-3-[(3S)-oxolan-3-yl]oxybenzonitrile;sulfane.
What is the SMILES notation for 6-bromo-2-fluoro-3-[(3S)-oxolan-3-yl]oxybenzonitrile;sulfane?
The canonical SMILES for 6-bromo-2-fluoro-3-[(3S)-oxolan-3-yl]oxybenzonitrile;sulfane is N#Cc1c(Br)ccc(O[C@H]2CCOC2)c1F.S.
What is the InChIKey of 6-bromo-2-fluoro-3-[(3S)-oxolan-3-yl]oxybenzonitrile;sulfane?
The InChIKey is IXGGEQFKXQSGSG-FJXQXJEOSA-N. The full InChI is InChI=1S/C11H9BrFNO2.H2S/c12-9-1-2-10(11(13)8(9)5-14)16-7-3-4-15-6-7;/h1-2,7H,3-4,6H2;1H2/t7-;/m0./s1.
What are the key properties of 6-bromo-2-fluoro-3-[(3S)-oxolan-3-yl]oxybenzonitrile;sulfane?
6-bromo-2-fluoro-3-[(3S)-oxolan-3-yl]oxybenzonitrile;sulfane has a molecular weight of 320.18 g/mol, XLogP of 2.74, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2-fluoro-3-[(3S)-oxolan-3-yl]oxybenzonitrile;sulfane is sourced from PubChem (CID 163664518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).