C10H12BrNO4S — CID 63559381
5-bromo-2-(oxolan-3-yloxy)benzenesulfonamide (PubChem CID 63559381) has the molecular formula C10H12BrNO4S and a molecular weight of 322.18 g/mol. Its IUPAC name is 5-bromo-2-(oxolan-3-yloxy)benzenesulfonamide.
| Compound Name | 5-bromo-2-(oxolan-3-yloxy)benzenesulfonamide |
|---|---|
| PubChem CID | 63559381 |
| Molecular Formula | C10H12BrNO4S |
| Molecular Weight | 322.18 g/mol |
| Exact Mass | 320.97 |
| IUPAC Name | 5-bromo-2-(oxolan-3-yloxy)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc(Br)ccc1OC1CCOC1 |
| InChI | InChI=1S/C10H12BrNO4S/c11-7-1-2-9(10(5-7)17(12,13)14)16-8-3-4-15-6-8/h1-2,5,8H,3-4,6H2,(H2,12,13,14) |
| InChIKey | MRHSTDIKMYIBNI-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.18 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |