C14H28NO3Si- — CID 163665765
tert-butyl-[(E,2R)-6-ethoxy-5-imino-6-oxohex-3-en-2-yl]oxy-dimethylsilanuide (PubChem CID 163665765) has the molecular formula C14H28NO3Si- and a molecular weight of 286.47 g/mol. Its IUPAC name is tert-butyl-[(E,2R)-6-ethoxy-5-imino-6-oxohex-3-en-2-yl]oxy-dimethylsilanuide.
| Compound Name | tert-butyl-[(E,2R)-6-ethoxy-5-imino-6-oxohex-3-en-2-yl]oxy-dimethylsilanuide |
|---|---|
| PubChem CID | 163665765 |
| Molecular Formula | C14H28NO3Si- |
| Molecular Weight | 286.47 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | tert-butyl-[(E,2R)-6-ethoxy-5-imino-6-oxohex-3-en-2-yl]oxy-dimethylsilanuide |
| SMILES | [H]/N=C(/C=C/[C@@H](C)O[SiH-](C)(C)C(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C14H28NO3Si/c1-8-17-13(16)12(15)10-9-11(2)18-19(6,7)14(3,4)5/h9-11,15,19H,8H2,1-7H3/q-1/b10-9+,15-12-/t11-/m1/s1 |
| InChIKey | IYHULATUPGMHSB-HBPBPLKESA-N |
| XLogP | 3.27 |
| TPSA | 59.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|