C14H15IN4O — CID 163667105
2-(aminomethyl)-6-[1-(iodoamino)-3-methyliminoprop-1-en-2-yl]-1H-quinolin-4-one (PubChem CID 163667105) has the molecular formula C14H15IN4O and a molecular weight of 382.21 g/mol. Its IUPAC name is 2-(aminomethyl)-6-[1-(iodoamino)-3-methyliminoprop-1-en-2-yl]-1H-quinolin-4-one.
| Compound Name | 2-(aminomethyl)-6-[1-(iodoamino)-3-methyliminoprop-1-en-2-yl]-1H-quinolin-4-one |
|---|---|
| PubChem CID | 163667105 |
| Molecular Formula | C14H15IN4O |
| Molecular Weight | 382.21 g/mol |
| Exact Mass | 382.03 |
| IUPAC Name | 2-(aminomethyl)-6-[1-(iodoamino)-3-methyliminoprop-1-en-2-yl]-1H-quinolin-4-one |
| SMILES | C/N=C/C(=CNI)c1ccc2[nH]c(CN)cc(=O)c2c1 |
| InChI | InChI=1S/C14H15IN4O/c1-17-7-10(8-18-15)9-2-3-13-12(4-9)14(20)5-11(6-16)19-13/h2-5,7-8,18H,6,16H2,1H3,(H,19,20)/b10-8?,17-7+ |
| InChIKey | COHHIDFMMOCXFY-JQTMIISWSA-N |
| XLogP | 1.97 |
| TPSA | 83.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.21 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|