C23H24N2O4 — CID 163667295
prop-2-enyl (6aS)-6-hydroxy-2,3-dimethyl-14-oxo-6,6a,7,12-tetrahydroisoquinolino[3,2-c][1,4]benzodiazepine-5-carboxylate (PubChem CID 163667295) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is prop-2-enyl (6aS)-6-hydroxy-2,3-dimethyl-14-oxo-6,6a,7,12-tetrahydroisoquinolino[3,2-c][1,4]benzodiazepine-5-carboxylate.
| Compound Name | prop-2-enyl (6aS)-6-hydroxy-2,3-dimethyl-14-oxo-6,6a,7,12-tetrahydroisoquinolino[3,2-c][1,4]benzodiazepine-5-carboxylate |
|---|---|
| PubChem CID | 163667295 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | prop-2-enyl (6aS)-6-hydroxy-2,3-dimethyl-14-oxo-6,6a,7,12-tetrahydroisoquinolino[3,2-c][1,4]benzodiazepine-5-carboxylate |
| SMILES | C=CCOC(=O)N1c2cc(C)c(C)cc2C(=O)N2Cc3ccccc3C[C@H]2C1O |
| InChI | InChI=1S/C23H24N2O4/c1-4-9-29-23(28)25-19-11-15(3)14(2)10-18(19)21(26)24-13-17-8-6-5-7-16(17)12-20(24)22(25)27/h4-8,10-11,20,22,27H,1,9,12-13H2,2-3H3/t20-,22?/m0/s1 |
| InChIKey | QOYSTUSMOMOWMJ-AIBWNMTMSA-N |
| XLogP | 3.33 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|