C19H28O8 — CID 163667516
2-[2-[2-[2-(2-acetyloxyethoxy)ethoxy]-4-methylphenoxy]ethoxy]ethyl acetate (PubChem CID 163667516) has the molecular formula C19H28O8 and a molecular weight of 384.43 g/mol. Its IUPAC name is 2-[2-[2-[2-(2-acetyloxyethoxy)ethoxy]-4-methylphenoxy]ethoxy]ethyl acetate.
| Compound Name | 2-[2-[2-[2-(2-acetyloxyethoxy)ethoxy]-4-methylphenoxy]ethoxy]ethyl acetate |
|---|---|
| PubChem CID | 163667516 |
| Molecular Formula | C19H28O8 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 2-[2-[2-[2-(2-acetyloxyethoxy)ethoxy]-4-methylphenoxy]ethoxy]ethyl acetate |
| SMILES | CC(=O)OCCOCCOc1ccc(C)cc1OCCOCCOC(C)=O |
| InChI | InChI=1S/C19H28O8/c1-15-4-5-18(26-12-8-22-6-10-24-16(2)20)19(14-15)27-13-9-23-7-11-25-17(3)21/h4-5,14H,6-13H2,1-3H3 |
| InChIKey | IZTMGWOJAWKZPI-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|