C17H16Cl3FO — CID 163669209
1-chloro-4-[1,4-dichloro-3-(4-methoxyphenyl)butan-2-yl]-2-fluorobenzene (PubChem CID 163669209) has the molecular formula C17H16Cl3FO and a molecular weight of 361.67 g/mol. Its IUPAC name is 1-chloro-4-[1,4-dichloro-3-(4-methoxyphenyl)butan-2-yl]-2-fluorobenzene.
| Compound Name | 1-chloro-4-[1,4-dichloro-3-(4-methoxyphenyl)butan-2-yl]-2-fluorobenzene |
|---|---|
| PubChem CID | 163669209 |
| Molecular Formula | C17H16Cl3FO |
| Molecular Weight | 361.67 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | 1-chloro-4-[1,4-dichloro-3-(4-methoxyphenyl)butan-2-yl]-2-fluorobenzene |
| SMILES | COc1ccc(C(CCl)C(CCl)c2ccc(Cl)c(F)c2)cc1 |
| InChI | InChI=1S/C17H16Cl3FO/c1-22-13-5-2-11(3-6-13)14(9-18)15(10-19)12-4-7-16(20)17(21)8-12/h2-8,14-15H,9-10H2,1H3 |
| InChIKey | JBBABDSNWSGVFL-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.67 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|