C23H25N4O4S- — CID 163669934
[1-cyclopentyl-2-oxo-4-[4-(thiophene-2-carbonyl)piperazin-1-yl]quinolin-3-yl]-dioxidoazanium (PubChem CID 163669934) has the molecular formula C23H25N4O4S- and a molecular weight of 453.54 g/mol. Its IUPAC name is [1-cyclopentyl-2-oxo-4-[4-(thiophene-2-carbonyl)piperazin-1-yl]quinolin-3-yl]-dioxidoazanium.
| Compound Name | [1-cyclopentyl-2-oxo-4-[4-(thiophene-2-carbonyl)piperazin-1-yl]quinolin-3-yl]-dioxidoazanium |
|---|---|
| PubChem CID | 163669934 |
| Molecular Formula | C23H25N4O4S- |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | [1-cyclopentyl-2-oxo-4-[4-(thiophene-2-carbonyl)piperazin-1-yl]quinolin-3-yl]-dioxidoazanium |
| SMILES | O=C(c1cccs1)N1CCN(c2c([NH+]([O-])[O-])c(=O)n(C3CCCC3)c3ccccc23)CC1 |
| InChI | InChI=1S/C23H25N4O4S/c28-22(19-10-5-15-32-19)25-13-11-24(12-14-25)20-17-8-3-4-9-18(17)26(16-6-1-2-7-16)23(29)21(20)27(30)31/h3-5,8-10,15-16,27H,1-2,6-7,11-14H2/q-1 |
| InChIKey | JBPYSVYDERCKGB-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|