C20H33NO4S — CID 163671687
tert-butyl N-[(2S)-3-methyl-1-[(4-propan-2-ylsulfinylphenyl)methoxy]butan-2-yl]carbamate (PubChem CID 163671687) has the molecular formula C20H33NO4S and a molecular weight of 383.55 g/mol. Its IUPAC name is tert-butyl N-[(2S)-3-methyl-1-[(4-propan-2-ylsulfinylphenyl)methoxy]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-3-methyl-1-[(4-propan-2-ylsulfinylphenyl)methoxy]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 163671687 |
| Molecular Formula | C20H33NO4S |
| Molecular Weight | 383.55 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | tert-butyl N-[(2S)-3-methyl-1-[(4-propan-2-ylsulfinylphenyl)methoxy]butan-2-yl]carbamate |
| SMILES | CC(C)[C@@H](COCc1ccc(S(=O)C(C)C)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H33NO4S/c1-14(2)18(21-19(22)25-20(5,6)7)13-24-12-16-8-10-17(11-9-16)26(23)15(3)4/h8-11,14-15,18H,12-13H2,1-7H3,(H,21,22)/t18-,26?/m1/s1 |
| InChIKey | JDCLYEYGJLIJFN-QOBPCVTDSA-N |
| XLogP | 4.27 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.55 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |