C11H19F2NOS — CID 163672162
1-[(2R)-4,4-difluoro-2-(2-sulfanylpropyl)pyrrolidin-1-yl]-2-methylpropan-1-one (PubChem CID 163672162) has the molecular formula C11H19F2NOS and a molecular weight of 251.34 g/mol. Its IUPAC name is 1-[(2R)-4,4-difluoro-2-(2-sulfanylpropyl)pyrrolidin-1-yl]-2-methylpropan-1-one.
| Compound Name | 1-[(2R)-4,4-difluoro-2-(2-sulfanylpropyl)pyrrolidin-1-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 163672162 |
| Molecular Formula | C11H19F2NOS |
| Molecular Weight | 251.34 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 1-[(2R)-4,4-difluoro-2-(2-sulfanylpropyl)pyrrolidin-1-yl]-2-methylpropan-1-one |
| SMILES | CC(S)C[C@H]1CC(F)(F)CN1C(=O)C(C)C |
| InChI | InChI=1S/C11H19F2NOS/c1-7(2)10(15)14-6-11(12,13)5-9(14)4-8(3)16/h7-9,16H,4-6H2,1-3H3/t8?,9-/m0/s1 |
| InChIKey | JDMRHXKFGFNJET-GKAPJAKFSA-N |
| XLogP | 2.59 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.34 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|