C8H12F3NOS — CID 168669155
4-(sulfanylmethyl)-1-(1,1,1-trifluoropropan-2-yl)pyrrolidin-2-one (PubChem CID 168669155) has the molecular formula C8H12F3NOS and a molecular weight of 227.25 g/mol. Its IUPAC name is 4-(sulfanylmethyl)-1-(1,1,1-trifluoropropan-2-yl)pyrrolidin-2-one.
| Compound Name | 4-(sulfanylmethyl)-1-(1,1,1-trifluoropropan-2-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168669155 |
| Molecular Formula | C8H12F3NOS |
| Molecular Weight | 227.25 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | 4-(sulfanylmethyl)-1-(1,1,1-trifluoropropan-2-yl)pyrrolidin-2-one |
| SMILES | CC(N1CC(CS)CC1=O)C(F)(F)F |
| InChI | InChI=1S/C8H12F3NOS/c1-5(8(9,10)11)12-3-6(4-14)2-7(12)13/h5-6,14H,2-4H2,1H3 |
| InChIKey | QPFVKSLDFOEZBM-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.25 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|