C15H16F3NO — CID 163672586
3-[4-methyl-3-(trifluoromethyl)phenyl]-3a,4,5,6,7,7a-hexahydro-1,2-benzoxazole (PubChem CID 163672586) has the molecular formula C15H16F3NO and a molecular weight of 283.29 g/mol. Its IUPAC name is 3-[4-methyl-3-(trifluoromethyl)phenyl]-3a,4,5,6,7,7a-hexahydro-1,2-benzoxazole.
| Compound Name | 3-[4-methyl-3-(trifluoromethyl)phenyl]-3a,4,5,6,7,7a-hexahydro-1,2-benzoxazole |
|---|---|
| PubChem CID | 163672586 |
| Molecular Formula | C15H16F3NO |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 3-[4-methyl-3-(trifluoromethyl)phenyl]-3a,4,5,6,7,7a-hexahydro-1,2-benzoxazole |
| SMILES | Cc1ccc(C2=NOC3CCCCC23)cc1C(F)(F)F |
| InChI | InChI=1S/C15H16F3NO/c1-9-6-7-10(8-12(9)15(16,17)18)14-11-4-2-3-5-13(11)20-19-14/h6-8,11,13H,2-5H2,1H3 |
| InChIKey | JDWCDWXBIAZSQD-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |