C23H21N7O2 — CID 163673985
4-[(1E)-1-[(2-amino-2-oxoethylidene)amino]buta-1,3-dien-2-yl]-N-[3-(4-cyclopropyl-1,2,4-triazol-3-yl)phenyl]pyridine-2-carboxamide (PubChem CID 163673985) has the molecular formula C23H21N7O2 and a molecular weight of 427.47 g/mol. Its IUPAC name is 4-[(1E)-1-[(2-amino-2-oxoethylidene)amino]buta-1,3-dien-2-yl]-N-[3-(4-cyclopropyl-1,2,4-triazol-3-yl)phenyl]pyridine-2-carboxamide.
| Compound Name | 4-[(1E)-1-[(2-amino-2-oxoethylidene)amino]buta-1,3-dien-2-yl]-N-[3-(4-cyclopropyl-1,2,4-triazol-3-yl)phenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 163673985 |
| Molecular Formula | C23H21N7O2 |
| Molecular Weight | 427.47 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 4-[(1E)-1-[(2-amino-2-oxoethylidene)amino]buta-1,3-dien-2-yl]-N-[3-(4-cyclopropyl-1,2,4-triazol-3-yl)phenyl]pyridine-2-carboxamide |
| SMILES | C=C/C(=C\N=C\C(N)=O)c1ccnc(C(=O)Nc2cccc(-c3nncn3C3CC3)c2)c1 |
| InChI | InChI=1S/C23H21N7O2/c1-2-15(12-25-13-21(24)31)16-8-9-26-20(11-16)23(32)28-18-5-3-4-17(10-18)22-29-27-14-30(22)19-6-7-19/h2-5,8-14,19H,1,6-7H2,(H2,24,31)(H,28,32)/b15-12+,25-13+ |
| InChIKey | JFALXWLCSDELBQ-OHVBCZJISA-N |
| XLogP | 3.01 |
| TPSA | 128.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.47 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|