C23H23N7O — CID 166691005
(3E)-4-(2-amino-3-pyridinyl)-N-[3-(4-cyclopropyl-1,2,4-triazol-3-yl)phenyl]-2-methyliminohexa-3,5-dienamide (PubChem CID 166691005) has the molecular formula C23H23N7O and a molecular weight of 413.49 g/mol. Its IUPAC name is (3E)-4-(2-amino-3-pyridinyl)-N-[3-(4-cyclopropyl-1,2,4-triazol-3-yl)phenyl]-2-methyliminohexa-3,5-dienamide.
| Compound Name | (3E)-4-(2-amino-3-pyridinyl)-N-[3-(4-cyclopropyl-1,2,4-triazol-3-yl)phenyl]-2-methyliminohexa-3,5-dienamide |
|---|---|
| PubChem CID | 166691005 |
| Molecular Formula | C23H23N7O |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | (3E)-4-(2-amino-3-pyridinyl)-N-[3-(4-cyclopropyl-1,2,4-triazol-3-yl)phenyl]-2-methyliminohexa-3,5-dienamide |
| SMILES | C=C/C(=C\C(=N/C)C(=O)Nc1cccc(-c2nncn2C2CC2)c1)c1cccnc1N |
| InChI | InChI=1S/C23H23N7O/c1-3-15(19-8-5-11-26-21(19)24)13-20(25-2)23(31)28-17-7-4-6-16(12-17)22-29-27-14-30(22)18-9-10-18/h3-8,11-14,18H,1,9-10H2,2H3,(H2,24,26)(H,28,31)/b15-13+,25-20+ |
| InChIKey | XQIIJDUYGJMIKP-KXPZFGARSA-N |
| XLogP | 3.54 |
| TPSA | 111.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|