C11H12N4O2 — CID 163675809
2-[(1-methylimidazol-2-yl)methylideneamino]-1-(5-methyl-1,2-oxazol-3-yl)ethanone (PubChem CID 163675809) has the molecular formula C11H12N4O2 and a molecular weight of 232.24 g/mol. Its IUPAC name is 2-[(1-methylimidazol-2-yl)methylideneamino]-1-(5-methyl-1,2-oxazol-3-yl)ethanone.
| Compound Name | 2-[(1-methylimidazol-2-yl)methylideneamino]-1-(5-methyl-1,2-oxazol-3-yl)ethanone |
|---|---|
| PubChem CID | 163675809 |
| Molecular Formula | C11H12N4O2 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 2-[(1-methylimidazol-2-yl)methylideneamino]-1-(5-methyl-1,2-oxazol-3-yl)ethanone |
| SMILES | Cc1cc(C(=O)C/N=C/c2nccn2C)no1 |
| InChI | InChI=1S/C11H12N4O2/c1-8-5-9(14-17-8)10(16)6-12-7-11-13-3-4-15(11)2/h3-5,7H,6H2,1-2H3/b12-7+ |
| InChIKey | JGOZYQOISXTQGR-KPKJPENVSA-N |
| XLogP | 1.02 |
| TPSA | 73.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|