C15H29NO6 — CID 163676087
2-[(2-hydroxy-2-propoxypentyl)-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetic acid (PubChem CID 163676087) has the molecular formula C15H29NO6 and a molecular weight of 319.40 g/mol. Its IUPAC name is 2-[(2-hydroxy-2-propoxypentyl)-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetic acid.
| Compound Name | 2-[(2-hydroxy-2-propoxypentyl)-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 163676087 |
| Molecular Formula | C15H29NO6 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | 2-[(2-hydroxy-2-propoxypentyl)-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetic acid |
| SMILES | CCCOC(O)(CCC)CN(CC(=O)O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H29NO6/c1-6-8-15(20,21-9-7-2)11-16(10-12(17)18)13(19)22-14(3,4)5/h20H,6-11H2,1-5H3,(H,17,18) |
| InChIKey | JGVILRNOXFMTHR-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|