About butane;1-methanidyl-9H-fluorene;uranium(2+)
butane;1-methanidyl-9H-fluorene;uranium(2+) (PubChem CID 163676514) has the molecular formula C18H20U
and a molecular weight of 474.39 g/mol. Its IUPAC name is butane;1-methanidyl-9H-fluorene;uranium(2+).
Molecular Properties
| Compound Name | butane;1-methanidyl-9H-fluorene;uranium(2+) |
| PubChem CID | 163676514 |
| Molecular Formula | C18H20U |
| Molecular Weight | 474.39 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | butane;1-methanidyl-9H-fluorene;uranium(2+) |
| SMILES | C[CH-]CC.[CH2-]c1cccc2c1Cc1ccccc1-2.[U+2] |
| InChI | InChI=1S/C14H11.C4H9.U/c1-10-5-4-8-13-12-7-3-2-6-11(12)9-14(10)13;1-3-4-2;/h2-8H,1,9H2;3H,4H2,1-2H3;/q2*-1;+2 |
| InChIKey | XGWCTLUPZKBTQM-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 474.39 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze butane;1-methanidyl-9H-fluorene;uranium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;1-methanidyl-9H-fluorene;uranium(2+)?
The IUPAC name of butane;1-methanidyl-9H-fluorene;uranium(2+) (CID 163676514) is butane;1-methanidyl-9H-fluorene;uranium(2+).
What is the SMILES notation for butane;1-methanidyl-9H-fluorene;uranium(2+)?
The canonical SMILES for butane;1-methanidyl-9H-fluorene;uranium(2+) is C[CH-]CC.[CH2-]c1cccc2c1Cc1ccccc1-2.[U+2].
What is the InChIKey of butane;1-methanidyl-9H-fluorene;uranium(2+)?
The InChIKey is XGWCTLUPZKBTQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11.C4H9.U/c1-10-5-4-8-13-12-7-3-2-6-11(12)9-14(10)13;1-3-4-2;/h2-8H,1,9H2;3H,4H2,1-2H3;/q2*-1;+2.
What are the key properties of butane;1-methanidyl-9H-fluorene;uranium(2+)?
butane;1-methanidyl-9H-fluorene;uranium(2+) has a molecular weight of 474.39 g/mol, XLogP of 5.06, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for butane;1-methanidyl-9H-fluorene;uranium(2+) is sourced from PubChem (CID 163676514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).