C11H23N3 — CID 163677232
1-cyclohexylpiperidine-2,3-diamine (PubChem CID 163677232) has the molecular formula C11H23N3 and a molecular weight of 197.33 g/mol. Its IUPAC name is 1-cyclohexylpiperidine-2,3-diamine.
| Compound Name | 1-cyclohexylpiperidine-2,3-diamine |
|---|---|
| PubChem CID | 163677232 |
| Molecular Formula | C11H23N3 |
| Molecular Weight | 197.33 g/mol |
| Exact Mass | 197.19 |
| IUPAC Name | 1-cyclohexylpiperidine-2,3-diamine |
| SMILES | NC1CCCN(C2CCCCC2)C1N |
| InChI | InChI=1S/C11H23N3/c12-10-7-4-8-14(11(10)13)9-5-2-1-3-6-9/h9-11H,1-8,12-13H2 |
| InChIKey | JHSKGVDETPZZQC-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.33 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |