C23H29N3O3S — CID 163678668
N-[(2S)-1-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)-3,4-dimethyl-1-oxopent-3-en-2-yl]cyclohexanecarboxamide (PubChem CID 163678668) has the molecular formula C23H29N3O3S and a molecular weight of 427.57 g/mol. Its IUPAC name is N-[(2S)-1-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)-3,4-dimethyl-1-oxopent-3-en-2-yl]cyclohexanecarboxamide.
| Compound Name | N-[(2S)-1-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)-3,4-dimethyl-1-oxopent-3-en-2-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 163678668 |
| Molecular Formula | C23H29N3O3S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | N-[(2S)-1-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)-3,4-dimethyl-1-oxopent-3-en-2-yl]cyclohexanecarboxamide |
| SMILES | CC(C)=C(C)[C@H](NC(=O)C1CCCCC1)C(=O)c1nnc(SCc2ccccc2)o1 |
| InChI | InChI=1S/C23H29N3O3S/c1-15(2)16(3)19(24-21(28)18-12-8-5-9-13-18)20(27)22-25-26-23(29-22)30-14-17-10-6-4-7-11-17/h4,6-7,10-11,18-19H,5,8-9,12-14H2,1-3H3,(H,24,28)/t19-/m0/s1 |
| InChIKey | JIYOSMMJRLMUMJ-IBGZPJMESA-N |
| XLogP | 4.97 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|