C57H50N2O — CID 163678757
6-[9-[1-(9,9-dimethyl-3,4,4b,8a-tetrahydrofluoren-1-yl)-3,4,7,8-tetrahydrodibenzofuran-3-yl]-3,4-dihydrocarbazol-3-yl]-9-phenyl-3,4-dihydrocarbazole (PubChem CID 163678757) has the molecular formula C57H50N2O and a molecular weight of 779.04 g/mol. Its IUPAC name is 6-[9-[1-(9,9-dimethyl-3,4,4b,8a-tetrahydrofluoren-1-yl)-3,4,7,8-tetrahydrodibenzofuran-3-yl]-3,4-dihydrocarbazol-3-yl]-9-phenyl-3,4-dihydrocarbazole.
| Compound Name | 6-[9-[1-(9,9-dimethyl-3,4,4b,8a-tetrahydrofluoren-1-yl)-3,4,7,8-tetrahydrodibenzofuran-3-yl]-3,4-dihydrocarbazol-3-yl]-9-phenyl-3,4-dihydrocarbazole |
|---|---|
| PubChem CID | 163678757 |
| Molecular Formula | C57H50N2O |
| Molecular Weight | 779.04 g/mol |
| Exact Mass | 778.39 |
| IUPAC Name | 6-[9-[1-(9,9-dimethyl-3,4,4b,8a-tetrahydrofluoren-1-yl)-3,4,7,8-tetrahydrodibenzofuran-3-yl]-3,4-dihydrocarbazol-3-yl]-9-phenyl-3,4-dihydrocarbazole |
| SMILES | CC1(C)C2=C(CCC=C2C2=CC(n3c4c(c5ccccc53)CC(c3ccc5c(c3)c3c(n5-c5ccccc5)C=CCC3)C=C4)Cc3oc4c(c32)=CCCC=4)C2C=CC=CC21 |
| InChI | InChI=1S/C57H50N2O/c1-57(2)48-23-10-6-17-39(48)42-21-14-22-43(56(42)57)47-33-38(34-54-55(47)44-20-9-13-26-53(44)60-54)59-50-25-12-8-19-41(50)46-32-36(28-30-52(46)59)35-27-29-51-45(31-35)40-18-7-11-24-49(40)58(51)37-15-4-3-5-16-37/h3-6,8,10-12,15-17,19-20,22-31,33,36,38-39,48H,7,9,13-14,18,21,32,34H2,1-2H3 |
| InChIKey | JJAGGGMBCOLJHS-UHFFFAOYSA-N |
| XLogP | 12.44 |
| TPSA | 23.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.04 |
| LogP ≤ 5 | 12.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |