C8H17NO — CID 163679151
N,N-bis(3-tritiopropyl)acetamide (PubChem CID 163679151) has the molecular formula C8H17NO and a molecular weight of 147.25 g/mol. Its IUPAC name is N,N-bis(3-tritiopropyl)acetamide.
| Compound Name | N,N-bis(3-tritiopropyl)acetamide |
|---|---|
| PubChem CID | 163679151 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 147.25 g/mol |
| Exact Mass | 147.15 |
| IUPAC Name | N,N-bis(3-tritiopropyl)acetamide |
| SMILES | [3H]CCCN(CCC[3H])C(C)=O |
| InChI | InChI=1S/C8H17NO/c1-4-6-9(7-5-2)8(3)10/h4-7H2,1-3H3/i1T,2T |
| InChIKey | IFTIBNDWGNYRLS-RVQWGROCSA-N |
| XLogP | 1.65 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.25 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |