C11H13NO6 — CID 163679496
dimethyl 5-methyl-4-nitrocyclohexa-1,3-diene-1,2-dicarboxylate (PubChem CID 163679496) has the molecular formula C11H13NO6 and a molecular weight of 255.23 g/mol. Its IUPAC name is dimethyl 5-methyl-4-nitrocyclohexa-1,3-diene-1,2-dicarboxylate.
| Compound Name | dimethyl 5-methyl-4-nitrocyclohexa-1,3-diene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 163679496 |
| Molecular Formula | C11H13NO6 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | dimethyl 5-methyl-4-nitrocyclohexa-1,3-diene-1,2-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)CC(C)C([N+](=O)[O-])=C1 |
| InChI | InChI=1S/C11H13NO6/c1-6-4-7(10(13)17-2)8(11(14)18-3)5-9(6)12(15)16/h5-6H,4H2,1-3H3 |
| InChIKey | JJPKSTVQYMBMQI-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|