C26H38F3N3O4 — CID 163680501
(2R,5S)-5-tert-butyl-N-[(1S)-1-cyano-2-[(3R)-5,5-dimethyl-2-oxopyrrolidin-3-yl]ethyl]-8,8,8-trifluoro-2-[(1-methylcyclopropyl)methyl]-4,7-dioxooctanamide (PubChem CID 163680501) has the molecular formula C26H38F3N3O4 and a molecular weight of 513.60 g/mol. Its IUPAC name is (2R,5S)-5-tert-butyl-N-[(1S)-1-cyano-2-[(3R)-5,5-dimethyl-2-oxopyrrolidin-3-yl]ethyl]-8,8,8-trifluoro-2-[(1-methylcyclopropyl)methyl]-4,7-dioxooctanamide.
| Compound Name | (2R,5S)-5-tert-butyl-N-[(1S)-1-cyano-2-[(3R)-5,5-dimethyl-2-oxopyrrolidin-3-yl]ethyl]-8,8,8-trifluoro-2-[(1-methylcyclopropyl)methyl]-4,7-dioxooctanamide |
|---|---|
| PubChem CID | 163680501 |
| Molecular Formula | C26H38F3N3O4 |
| Molecular Weight | 513.60 g/mol |
| Exact Mass | 513.28 |
| IUPAC Name | (2R,5S)-5-tert-butyl-N-[(1S)-1-cyano-2-[(3R)-5,5-dimethyl-2-oxopyrrolidin-3-yl]ethyl]-8,8,8-trifluoro-2-[(1-methylcyclopropyl)methyl]-4,7-dioxooctanamide |
| SMILES | CC1(C[C@H](CC(=O)C(CC(=O)C(F)(F)F)C(C)(C)C)C(=O)N[C@H](C#N)C[C@@H]2CC(C)(C)NC2=O)CC1 |
| InChI | InChI=1S/C26H38F3N3O4/c1-23(2,3)18(11-20(34)26(27,28)29)19(33)10-16(13-25(6)7-8-25)21(35)31-17(14-30)9-15-12-24(4,5)32-22(15)36/h15-18H,7-13H2,1-6H3,(H,31,35)(H,32,36)/t15-,16+,17+,18?/m1/s1 |
| InChIKey | JKKMUUKCDSUOEH-KKSQLVLISA-N |
| XLogP | 4.25 |
| TPSA | 116.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.60 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |