C23H38F3N5O4Si — CID 168834305
N-[1-[[1-cyano-2-(5,5-dimethyl-2-oxopyrrolidin-3-yl)ethyl]amino]-1-oxo-3-trimethylsilylpropan-2-yl]-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanamide (PubChem CID 168834305) has the molecular formula C23H38F3N5O4Si and a molecular weight of 533.67 g/mol. Its IUPAC name is N-[1-[[1-cyano-2-(5,5-dimethyl-2-oxopyrrolidin-3-yl)ethyl]amino]-1-oxo-3-trimethylsilylpropan-2-yl]-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanamide.
| Compound Name | N-[1-[[1-cyano-2-(5,5-dimethyl-2-oxopyrrolidin-3-yl)ethyl]amino]-1-oxo-3-trimethylsilylpropan-2-yl]-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanamide |
|---|---|
| PubChem CID | 168834305 |
| Molecular Formula | C23H38F3N5O4Si |
| Molecular Weight | 533.67 g/mol |
| Exact Mass | 533.26 |
| IUPAC Name | N-[1-[[1-cyano-2-(5,5-dimethyl-2-oxopyrrolidin-3-yl)ethyl]amino]-1-oxo-3-trimethylsilylpropan-2-yl]-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanamide |
| SMILES | CC1(C)CC(CC(C#N)NC(=O)C(C[Si](C)(C)C)NC(=O)C(NC(=O)C(F)(F)F)C(C)(C)C)C(=O)N1 |
| InChI | InChI=1S/C23H38F3N5O4Si/c1-21(2,3)16(30-20(35)23(24,25)26)19(34)29-15(12-36(6,7)8)18(33)28-14(11-27)9-13-10-22(4,5)31-17(13)32/h13-16H,9-10,12H2,1-8H3,(H,28,33)(H,29,34)(H,30,35)(H,31,32) |
| InChIKey | WVALRVRCZKZDSW-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 140.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.67 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|