About N-[(3,5-dimethyl-2H-pyrrol-4-yl)methyl]propan-2-amine
N-[(3,5-dimethyl-2H-pyrrol-4-yl)methyl]propan-2-amine (PubChem CID 163681124) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is N-[(3,5-dimethyl-2H-pyrrol-4-yl)methyl]propan-2-amine.
Analyze N-[(3,5-dimethyl-2H-pyrrol-4-yl)methyl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,5-dimethyl-2H-pyrrol-4-yl)methyl]propan-2-amine?
The IUPAC name of N-[(3,5-dimethyl-2H-pyrrol-4-yl)methyl]propan-2-amine (CID 163681124) is N-[(3,5-dimethyl-2H-pyrrol-4-yl)methyl]propan-2-amine.
What is the SMILES notation for N-[(3,5-dimethyl-2H-pyrrol-4-yl)methyl]propan-2-amine?
The canonical SMILES for N-[(3,5-dimethyl-2H-pyrrol-4-yl)methyl]propan-2-amine is CC1=NCC(C)=C1CNC(C)C.
What is the InChIKey of N-[(3,5-dimethyl-2H-pyrrol-4-yl)methyl]propan-2-amine?
The InChIKey is AHVOYRGRRSSLLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2/c1-7(2)11-6-10-8(3)5-12-9(10)4/h7,11H,5-6H2,1-4H3.
What are the key properties of N-[(3,5-dimethyl-2H-pyrrol-4-yl)methyl]propan-2-amine?
N-[(3,5-dimethyl-2H-pyrrol-4-yl)methyl]propan-2-amine has a molecular weight of 166.27 g/mol, XLogP of 1.78, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,5-dimethyl-2H-pyrrol-4-yl)methyl]propan-2-amine is sourced from PubChem (CID 163681124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).