C18H33F3N2O — CID 163681568
(3E,5E)-3-methyl-2-N-propan-2-yl-1-N-[(1R)-1-propan-2-yloxyethyl]-6-(trifluoromethyl)octa-3,5-diene-1,2-diamine (PubChem CID 163681568) has the molecular formula C18H33F3N2O and a molecular weight of 350.47 g/mol. Its IUPAC name is (3E,5E)-3-methyl-2-N-propan-2-yl-1-N-[(1R)-1-propan-2-yloxyethyl]-6-(trifluoromethyl)octa-3,5-diene-1,2-diamine.
| Compound Name | (3E,5E)-3-methyl-2-N-propan-2-yl-1-N-[(1R)-1-propan-2-yloxyethyl]-6-(trifluoromethyl)octa-3,5-diene-1,2-diamine |
|---|---|
| PubChem CID | 163681568 |
| Molecular Formula | C18H33F3N2O |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | (3E,5E)-3-methyl-2-N-propan-2-yl-1-N-[(1R)-1-propan-2-yloxyethyl]-6-(trifluoromethyl)octa-3,5-diene-1,2-diamine |
| SMILES | CC/C(=C\C=C(/C)C(CN[C@@H](C)OC(C)C)NC(C)C)C(F)(F)F |
| InChI | InChI=1S/C18H33F3N2O/c1-8-16(18(19,20)21)10-9-14(6)17(23-12(2)3)11-22-15(7)24-13(4)5/h9-10,12-13,15,17,22-23H,8,11H2,1-7H3/b14-9+,16-10+/t15-,17?/m1/s1 |
| InChIKey | JLGSZDRVVLRSGY-SEPCDSBDSA-N |
| XLogP | 4.56 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|