C20H35F3N2O — CID 142906932
1-N-ethyl-3-N-(2-propan-2-yloxyethyl)-3-N-[(2E)-2-[(E)-1,1,1-trifluorobut-2-en-2-yl]penta-2,4-dienyl]butane-1,3-diamine (PubChem CID 142906932) has the molecular formula C20H35F3N2O and a molecular weight of 376.51 g/mol. Its IUPAC name is 1-N-ethyl-3-N-(2-propan-2-yloxyethyl)-3-N-[(2E)-2-[(E)-1,1,1-trifluorobut-2-en-2-yl]penta-2,4-dienyl]butane-1,3-diamine.
| Compound Name | 1-N-ethyl-3-N-(2-propan-2-yloxyethyl)-3-N-[(2E)-2-[(E)-1,1,1-trifluorobut-2-en-2-yl]penta-2,4-dienyl]butane-1,3-diamine |
|---|---|
| PubChem CID | 142906932 |
| Molecular Formula | C20H35F3N2O |
| Molecular Weight | 376.51 g/mol |
| Exact Mass | 376.27 |
| IUPAC Name | 1-N-ethyl-3-N-(2-propan-2-yloxyethyl)-3-N-[(2E)-2-[(E)-1,1,1-trifluorobut-2-en-2-yl]penta-2,4-dienyl]butane-1,3-diamine |
| SMILES | C=C/C=C(CN(CCOC(C)C)C(C)CCNCC)\C(=C/C)C(F)(F)F |
| InChI | InChI=1S/C20H35F3N2O/c1-7-10-18(19(8-2)20(21,22)23)15-25(13-14-26-16(4)5)17(6)11-12-24-9-3/h7-8,10,16-17,24H,1,9,11-15H2,2-6H3/b18-10-,19-8+ |
| InChIKey | HCLWVFFXSTVDLF-VEOZXTEKSA-N |
| XLogP | 4.72 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.51 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|