C19H24N2O2SSi — CID 163683992
ethyl 5-[ethyl(dimethyl)silyl]-1-(1,3-thiazol-2-ylmethyl)indole-2-carboxylate (PubChem CID 163683992) has the molecular formula C19H24N2O2SSi and a molecular weight of 372.57 g/mol. Its IUPAC name is ethyl 5-[ethyl(dimethyl)silyl]-1-(1,3-thiazol-2-ylmethyl)indole-2-carboxylate.
| Compound Name | ethyl 5-[ethyl(dimethyl)silyl]-1-(1,3-thiazol-2-ylmethyl)indole-2-carboxylate |
|---|---|
| PubChem CID | 163683992 |
| Molecular Formula | C19H24N2O2SSi |
| Molecular Weight | 372.57 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | ethyl 5-[ethyl(dimethyl)silyl]-1-(1,3-thiazol-2-ylmethyl)indole-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc([Si](C)(C)CC)ccc2n1Cc1nccs1 |
| InChI | InChI=1S/C19H24N2O2SSi/c1-5-23-19(22)17-12-14-11-15(25(3,4)6-2)7-8-16(14)21(17)13-18-20-9-10-24-18/h7-12H,5-6,13H2,1-4H3 |
| InChIKey | JNFKLPXVKSFLPU-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.57 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|