C22H33O3S2- — CID 163685823
2-(1-cyclohexa-1,5-dien-1-ylsulfanyl-3-ethyl-2-hydroxy-3-methylheptyl)cyclohexa-2,4-diene-1-sulfinate (PubChem CID 163685823) has the molecular formula C22H33O3S2- and a molecular weight of 409.64 g/mol. Its IUPAC name is 2-(1-cyclohexa-1,5-dien-1-ylsulfanyl-3-ethyl-2-hydroxy-3-methylheptyl)cyclohexa-2,4-diene-1-sulfinate.
| Compound Name | 2-(1-cyclohexa-1,5-dien-1-ylsulfanyl-3-ethyl-2-hydroxy-3-methylheptyl)cyclohexa-2,4-diene-1-sulfinate |
|---|---|
| PubChem CID | 163685823 |
| Molecular Formula | C22H33O3S2- |
| Molecular Weight | 409.64 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 2-(1-cyclohexa-1,5-dien-1-ylsulfanyl-3-ethyl-2-hydroxy-3-methylheptyl)cyclohexa-2,4-diene-1-sulfinate |
| SMILES | CCCCC(C)(CC)C(O)C(SC1=CCCC=C1)C1=CC=CCC1S(=O)[O-] |
| InChI | InChI=1S/C22H34O3S2/c1-4-6-16-22(3,5-2)21(23)20(26-17-12-8-7-9-13-17)18-14-10-11-15-19(18)27(24)25/h8,10-14,19-21,23H,4-7,9,15-16H2,1-3H3,(H,24,25)/p-1 |
| InChIKey | VMQIMWMIYUBYNN-UHFFFAOYSA-M |
| XLogP | 5.42 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.64 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|