C25H25FN6O2S — CID 163687131
2-(3-aminobut-2-enethioylamino)-4-[[(2R)-1-amino-1-oxo-3-(4-pyridin-2-ylphenyl)propan-2-yl]amino]-5-fluorobenzamide (PubChem CID 163687131) has the molecular formula C25H25FN6O2S and a molecular weight of 492.58 g/mol. Its IUPAC name is 2-(3-aminobut-2-enethioylamino)-4-[[(2R)-1-amino-1-oxo-3-(4-pyridin-2-ylphenyl)propan-2-yl]amino]-5-fluorobenzamide.
| Compound Name | 2-(3-aminobut-2-enethioylamino)-4-[[(2R)-1-amino-1-oxo-3-(4-pyridin-2-ylphenyl)propan-2-yl]amino]-5-fluorobenzamide |
|---|---|
| PubChem CID | 163687131 |
| Molecular Formula | C25H25FN6O2S |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | 2-(3-aminobut-2-enethioylamino)-4-[[(2R)-1-amino-1-oxo-3-(4-pyridin-2-ylphenyl)propan-2-yl]amino]-5-fluorobenzamide |
| SMILES | CC(N)=CC(=S)Nc1cc(N[C@H](Cc2ccc(-c3ccccn3)cc2)C(N)=O)c(F)cc1C(N)=O |
| InChI | InChI=1S/C25H25FN6O2S/c1-14(27)10-23(35)32-20-13-21(18(26)12-17(20)24(28)33)31-22(25(29)34)11-15-5-7-16(8-6-15)19-4-2-3-9-30-19/h2-10,12-13,22,31H,11,27H2,1H3,(H2,28,33)(H2,29,34)(H,32,35)/t22-/m1/s1 |
| InChIKey | NALNSRSNYFYSHO-JOCHJYFZSA-N |
| XLogP | 3.10 |
| TPSA | 149.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|